C24H19N3O4S2 — CID 4595231
3-(4-hydroxyphenyl)-2-(3-hydroxyphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one (PubChem CID 4595231) has the molecular formula C24H19N3O4S2 and a molecular weight of 477.57 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2-(3-hydroxyphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-hydroxyphenyl)-2-(3-hydroxyphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4595231 |
| Molecular Formula | C24H19N3O4S2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2-(3-hydroxyphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc2c(c1)N(C)C(=C1S/C(=N\c3cccc(O)c3)N(c3ccc(O)cc3)C1=O)S2 |
| InChI | InChI=1S/C24H19N3O4S2/c1-26-19-13-18(31-2)10-11-20(19)32-23(26)21-22(30)27(15-6-8-16(28)9-7-15)24(33-21)25-14-4-3-5-17(29)12-14/h3-13,28-29H,1-2H3/b23-21?,25-24- |
| InChIKey | PEGBLRUXDVIQCQ-OJQMOGMSSA-N |
| XLogP | 5.29 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|