C26H23N3O4S2 — CID 3543729
5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-2-(4-hydroxy-3-methylphenyl)imino-3-(4-hydroxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 3543729) has the molecular formula C26H23N3O4S2 and a molecular weight of 505.62 g/mol. Its IUPAC name is 5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-2-(4-hydroxy-3-methylphenyl)imino-3-(4-hydroxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-2-(4-hydroxy-3-methylphenyl)imino-3-(4-hydroxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3543729 |
| Molecular Formula | C26H23N3O4S2 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-2-(4-hydroxy-3-methylphenyl)imino-3-(4-hydroxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=C2S/C(=N\c3ccc(O)c(C)c3)N(c3ccc(O)cc3)C2=O)Sc2ccc(OC)cc21 |
| InChI | InChI=1S/C26H23N3O4S2/c1-4-28-20-14-19(33-3)10-12-22(20)34-25(28)23-24(32)29(17-6-8-18(30)9-7-17)26(35-23)27-16-5-11-21(31)15(2)13-16/h5-14,30-31H,4H2,1-3H3/b25-23?,27-26- |
| InChIKey | FAIUKYSRJIOLKF-ZUAQKOPXSA-N |
| XLogP | 5.98 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|