C30H23N3O4S2 — CID 3098333
2-[[(5Z)-5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]anthracene-9,10-dione (PubChem CID 3098333) has the molecular formula C30H23N3O4S2 and a molecular weight of 553.67 g/mol. Its IUPAC name is 2-[[(5Z)-5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]anthracene-9,10-dione.
| Compound Name | 2-[[(5Z)-5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 3098333 |
| Molecular Formula | C30H23N3O4S2 |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.11 |
| IUPAC Name | 2-[[(5Z)-5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]anthracene-9,10-dione |
| SMILES | C=CCN1C(=O)/C(=C2/Sc3ccc(OC)cc3N2CC)S/C1=N\c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C30H23N3O4S2/c1-4-14-33-28(36)27(29-32(5-2)23-16-18(37-3)11-13-24(23)38-29)39-30(33)31-17-10-12-21-22(15-17)26(35)20-9-7-6-8-19(20)25(21)34/h4,6-13,15-16H,1,5,14H2,2-3H3/b29-27-,31-30- |
| InChIKey | ASVPFGLUUUBAPY-XTUVAWEBSA-N |
| XLogP | 6.02 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|