C22H21N3O2S2 — CID 3098321
(5Z)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-(4-methoxyphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 3098321) has the molecular formula C22H21N3O2S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is (5Z)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-(4-methoxyphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-(4-methoxyphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3098321 |
| Molecular Formula | C22H21N3O2S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (5Z)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-(4-methoxyphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C2/Sc3ccccc3N2CC)S/C1=N\c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H21N3O2S2/c1-4-14-25-20(26)19(21-24(5-2)17-8-6-7-9-18(17)28-21)29-22(25)23-15-10-12-16(27-3)13-11-15/h4,6-13H,1,5,14H2,2-3H3/b21-19-,23-22- |
| InChIKey | AOTCBWPEVLCLLV-BEIQUOEZSA-N |
| XLogP | 5.25 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|