C22H21N3O3S3 — CID 41168191
N-[(5E)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-methylbenzenesulfonamide (PubChem CID 41168191) has the molecular formula C22H21N3O3S3 and a molecular weight of 471.63 g/mol. Its IUPAC name is N-[(5E)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[(5E)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 41168191 |
| Molecular Formula | C22H21N3O3S3 |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | N-[(5E)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-methylbenzenesulfonamide |
| SMILES | C=CCN1C(=O)/C(=C2\Sc3ccccc3N2CC)SC1=NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H21N3O3S3/c1-4-14-25-20(26)19(21-24(5-2)17-8-6-7-9-18(17)29-21)30-22(25)23-31(27,28)16-12-10-15(3)11-13-16/h4,6-13H,1,5,14H2,2-3H3/b21-19+,23-22? |
| InChIKey | ISGZDIATQBBRIS-CUCKYGFWSA-N |
| XLogP | 4.60 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|