C19H16ClN3O3S3 — CID 18398183
(NZ)-4-chloro-N-[(5E)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 18398183) has the molecular formula C19H16ClN3O3S3 and a molecular weight of 466.01 g/mol. Its IUPAC name is (NZ)-4-chloro-N-[(5E)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | (NZ)-4-chloro-N-[(5E)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 18398183 |
| Molecular Formula | C19H16ClN3O3S3 |
| Molecular Weight | 466.01 g/mol |
| Exact Mass | 465.00 |
| IUPAC Name | (NZ)-4-chloro-N-[(5E)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | CCN1C(=O)/C(=C2\Sc3ccccc3N2C)S/C1=N\S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16ClN3O3S3/c1-3-23-17(24)16(18-22(2)14-6-4-5-7-15(14)27-18)28-19(23)21-29(25,26)13-10-8-12(20)9-11-13/h4-11H,3H2,1-2H3/b18-16+,21-19- |
| InChIKey | MHHFFRCLGPYAKU-DHZPKXATSA-N |
| XLogP | 4.39 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.01 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|