C24H24ClN3O3S2 — CID 51567113
4-chloro-N-[(5Z)-3-ethyl-4-oxo-5-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 51567113) has the molecular formula C24H24ClN3O3S2 and a molecular weight of 502.06 g/mol. Its IUPAC name is 4-chloro-N-[(5Z)-3-ethyl-4-oxo-5-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(5Z)-3-ethyl-4-oxo-5-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 51567113 |
| Molecular Formula | C24H24ClN3O3S2 |
| Molecular Weight | 502.06 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | 4-chloro-N-[(5Z)-3-ethyl-4-oxo-5-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | CCN1C(=O)/C(=C/C=C2/N(C)c3ccccc3C2(C)C)SC1=NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H24ClN3O3S2/c1-5-28-22(29)20(32-23(28)26-33(30,31)17-12-10-16(25)11-13-17)14-15-21-24(2,3)18-8-6-7-9-19(18)27(21)4/h6-15H,5H2,1-4H3/b20-14-,21-15+,26-23? |
| InChIKey | QBRJSJBCALPIGV-PRTUHBQHSA-N |
| XLogP | 5.18 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.06 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|