C18H14BrClN2O3S2 — CID 42228239
N-[(5Z)-5-[(4-bromophenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]-4-chlorobenzenesulfonamide (PubChem CID 42228239) has the molecular formula C18H14BrClN2O3S2 and a molecular weight of 485.81 g/mol. Its IUPAC name is N-[(5Z)-5-[(4-bromophenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]-4-chlorobenzenesulfonamide.
| Compound Name | N-[(5Z)-5-[(4-bromophenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 42228239 |
| Molecular Formula | C18H14BrClN2O3S2 |
| Molecular Weight | 485.81 g/mol |
| Exact Mass | 483.93 |
| IUPAC Name | N-[(5Z)-5-[(4-bromophenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]-4-chlorobenzenesulfonamide |
| SMILES | CCN1C(=O)/C(=C/c2ccc(Br)cc2)SC1=NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14BrClN2O3S2/c1-2-22-17(23)16(11-12-3-5-13(19)6-4-12)26-18(22)21-27(24,25)15-9-7-14(20)8-10-15/h3-11H,2H2,1H3/b16-11-,21-18? |
| InChIKey | ONJNWEFFNSZXOW-ALGNWURXSA-N |
| XLogP | 4.78 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.81 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|