C20H19BrN2O5S2 — CID 51567121
4-bromo-N-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 51567121) has the molecular formula C20H19BrN2O5S2 and a molecular weight of 511.42 g/mol. Its IUPAC name is 4-bromo-N-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | 4-bromo-N-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 51567121 |
| Molecular Formula | C20H19BrN2O5S2 |
| Molecular Weight | 511.42 g/mol |
| Exact Mass | 509.99 |
| IUPAC Name | 4-bromo-N-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | CCN1C(=O)/C(=C/c2ccc(OC)cc2OC)SC1=NS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H19BrN2O5S2/c1-4-23-19(24)18(11-13-5-8-15(27-2)12-17(13)28-3)29-20(23)22-30(25,26)16-9-6-14(21)7-10-16/h5-12H,4H2,1-3H3/b18-11-,22-20? |
| InChIKey | XUAOFQTVRLTIQA-WYWZIVHKSA-N |
| XLogP | 4.15 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|