C19H14Br2N2O3S2 — CID 4987476
4-bromo-N-[5-[(4-bromophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 4987476) has the molecular formula C19H14Br2N2O3S2 and a molecular weight of 542.27 g/mol. Its IUPAC name is 4-bromo-N-[5-[(4-bromophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | 4-bromo-N-[5-[(4-bromophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 4987476 |
| Molecular Formula | C19H14Br2N2O3S2 |
| Molecular Weight | 542.27 g/mol |
| Exact Mass | 539.88 |
| IUPAC Name | 4-bromo-N-[5-[(4-bromophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | C=CCN1C(=O)C(=Cc2ccc(Br)cc2)SC1=NS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H14Br2N2O3S2/c1-2-11-23-18(24)17(12-13-3-5-14(20)6-4-13)27-19(23)22-28(25,26)16-9-7-15(21)8-10-16/h2-10,12H,1,11H2 |
| InChIKey | DPXVBLQJTUCDIC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.27 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|