C21H20N2O3S2 — CID 6294561
(NE)-N-[(5Z)-5-benzylidene-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-ethylbenzenesulfonamide (PubChem CID 6294561) has the molecular formula C21H20N2O3S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is (NE)-N-[(5Z)-5-benzylidene-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-ethylbenzenesulfonamide.
| Compound Name | (NE)-N-[(5Z)-5-benzylidene-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 6294561 |
| Molecular Formula | C21H20N2O3S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | (NE)-N-[(5Z)-5-benzylidene-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-ethylbenzenesulfonamide |
| SMILES | C=CCN1C(=O)/C(=C/c2ccccc2)S/C1=N/S(=O)(=O)c1ccc(CC)cc1 |
| InChI | InChI=1S/C21H20N2O3S2/c1-3-14-23-20(24)19(15-17-8-6-5-7-9-17)27-21(23)22-28(25,26)18-12-10-16(4-2)11-13-18/h3,5-13,15H,1,4,14H2,2H3/b19-15-,22-21+ |
| InChIKey | YMRPGHAEIFMDGJ-LRXSNBMBSA-N |
| XLogP | 4.10 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|