C21H19BrN2O3S2 — CID 3331759
N-[5-[(4-bromophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-ethylbenzenesulfonamide (PubChem CID 3331759) has the molecular formula C21H19BrN2O3S2 and a molecular weight of 491.43 g/mol. Its IUPAC name is N-[5-[(4-bromophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-ethylbenzenesulfonamide.
| Compound Name | N-[5-[(4-bromophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3331759 |
| Molecular Formula | C21H19BrN2O3S2 |
| Molecular Weight | 491.43 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | N-[5-[(4-bromophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-ethylbenzenesulfonamide |
| SMILES | C=CCN1C(=O)C(=Cc2ccc(Br)cc2)SC1=NS(=O)(=O)c1ccc(CC)cc1 |
| InChI | InChI=1S/C21H19BrN2O3S2/c1-3-13-24-20(25)19(14-16-5-9-17(22)10-6-16)28-21(24)23-29(26,27)18-11-7-15(4-2)8-12-18/h3,5-12,14H,1,4,13H2,2H3 |
| InChIKey | PKEVHGBRHPHASL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|