C21H19FN2O5S2 — CID 2141620
N-[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide (PubChem CID 2141620) has the molecular formula C21H19FN2O5S2 and a molecular weight of 462.52 g/mol. Its IUPAC name is N-[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide.
| Compound Name | N-[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 2141620 |
| Molecular Formula | C21H19FN2O5S2 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | N-[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide |
| SMILES | C=CCN1C(=O)/C(=C\c2ccc(OC)c(OC)c2)SC1=NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H19FN2O5S2/c1-4-11-24-20(25)19(13-14-5-10-17(28-2)18(12-14)29-3)30-21(24)23-31(26,27)16-8-6-15(22)7-9-16/h4-10,12-13H,1,11H2,2-3H3/b19-13+,23-21? |
| InChIKey | LGVHDLZRPYSAOA-RPDORSEYSA-N |
| XLogP | 3.69 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|