C15H16FN3O3S2 — CID 3669236
N-[5-(dimethylaminomethylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide (PubChem CID 3669236) has the molecular formula C15H16FN3O3S2 and a molecular weight of 369.44 g/mol. Its IUPAC name is N-[5-(dimethylaminomethylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide.
| Compound Name | N-[5-(dimethylaminomethylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 3669236 |
| Molecular Formula | C15H16FN3O3S2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | N-[5-(dimethylaminomethylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide |
| SMILES | C=CCN1C(=O)C(=CN(C)C)SC1=NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H16FN3O3S2/c1-4-9-19-14(20)13(10-18(2)3)23-15(19)17-24(21,22)12-7-5-11(16)6-8-12/h4-8,10H,1,9H2,2-3H3 |
| InChIKey | KBJPLDYEQGHOEQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|