C28H35FN2O5S2 — CID 4266936
N-[3-ethyl-5-[(3-methoxy-4-nonoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide (PubChem CID 4266936) has the molecular formula C28H35FN2O5S2 and a molecular weight of 562.73 g/mol. Its IUPAC name is N-[3-ethyl-5-[(3-methoxy-4-nonoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide.
| Compound Name | N-[3-ethyl-5-[(3-methoxy-4-nonoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 4266936 |
| Molecular Formula | C28H35FN2O5S2 |
| Molecular Weight | 562.73 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | N-[3-ethyl-5-[(3-methoxy-4-nonoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide |
| SMILES | CCCCCCCCCOc1ccc(C=C2SC(=NS(=O)(=O)c3ccc(F)cc3)N(CC)C2=O)cc1OC |
| InChI | InChI=1S/C28H35FN2O5S2/c1-4-6-7-8-9-10-11-18-36-24-17-12-21(19-25(24)35-3)20-26-27(32)31(5-2)28(37-26)30-38(33,34)23-15-13-22(29)14-16-23/h12-17,19-20H,4-11,18H2,1-3H3 |
| InChIKey | WAULDOYVUURJHU-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.73 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|