C29H38N2O6S2 — CID 5201421
N-[5-[(3-methoxy-4-octoxyphenyl)methylidene]-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 5201421) has the molecular formula C29H38N2O6S2 and a molecular weight of 574.77 g/mol. Its IUPAC name is N-[5-[(3-methoxy-4-octoxyphenyl)methylidene]-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | N-[5-[(3-methoxy-4-octoxyphenyl)methylidene]-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 5201421 |
| Molecular Formula | C29H38N2O6S2 |
| Molecular Weight | 574.77 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | N-[5-[(3-methoxy-4-octoxyphenyl)methylidene]-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | CCCCCCCCOc1ccc(C=C2SC(=NS(=O)(=O)c3ccccc3)N(CCCOC)C2=O)cc1OC |
| InChI | InChI=1S/C29H38N2O6S2/c1-4-5-6-7-8-12-20-37-25-17-16-23(21-26(25)36-3)22-27-28(32)31(18-13-19-35-2)29(38-27)30-39(33,34)24-14-10-9-11-15-24/h9-11,14-17,21-22H,4-8,12-13,18-20H2,1-3H3 |
| InChIKey | IVCUBPREZZFEMZ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.77 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|