C27H34N2O5S2 — CID 98157058
N-[(5Z)-3-ethyl-5-[(4-heptoxy-3-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-methylbenzenesulfonamide (PubChem CID 98157058) has the molecular formula C27H34N2O5S2 and a molecular weight of 530.71 g/mol. Its IUPAC name is N-[(5Z)-3-ethyl-5-[(4-heptoxy-3-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[(5Z)-3-ethyl-5-[(4-heptoxy-3-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 98157058 |
| Molecular Formula | C27H34N2O5S2 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | N-[(5Z)-3-ethyl-5-[(4-heptoxy-3-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-methylbenzenesulfonamide |
| SMILES | CCCCCCCOc1ccc(/C=C2\SC(=NS(=O)(=O)c3ccc(C)cc3)N(CC)C2=O)cc1OC |
| InChI | InChI=1S/C27H34N2O5S2/c1-5-7-8-9-10-17-34-23-16-13-21(18-24(23)33-4)19-25-26(30)29(6-2)27(35-25)28-36(31,32)22-14-11-20(3)12-15-22/h11-16,18-19H,5-10,17H2,1-4H3/b25-19-,28-27? |
| InChIKey | FESFLMRVFKMQKT-PAPBZEPUSA-N |
| XLogP | 6.03 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|