C26H32N2O6S2 — CID 98157210
N-[(5Z)-5-[(3-methoxy-4-pentoxyphenyl)methylidene]-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 98157210) has the molecular formula C26H32N2O6S2 and a molecular weight of 532.68 g/mol. Its IUPAC name is N-[(5Z)-5-[(3-methoxy-4-pentoxyphenyl)methylidene]-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | N-[(5Z)-5-[(3-methoxy-4-pentoxyphenyl)methylidene]-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 98157210 |
| Molecular Formula | C26H32N2O6S2 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | N-[(5Z)-5-[(3-methoxy-4-pentoxyphenyl)methylidene]-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | CCCCCOc1ccc(/C=C2\SC(=NS(=O)(=O)c3ccccc3)N(CCCOC)C2=O)cc1OC |
| InChI | InChI=1S/C26H32N2O6S2/c1-4-5-9-17-34-22-14-13-20(18-23(22)33-3)19-24-25(29)28(15-10-16-32-2)26(35-24)27-36(30,31)21-11-7-6-8-12-21/h6-8,11-14,18-19H,4-5,9-10,15-17H2,1-3H3/b24-19-,27-26? |
| InChIKey | KVNRGOLIIXUEDW-VDJURDQESA-N |
| XLogP | 4.96 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|