C28H36N2O6S2 — CID 6082988
(NE)-N-[(5Z)-5-[(3-heptoxy-4-methoxyphenyl)methylidene]-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 6082988) has the molecular formula C28H36N2O6S2 and a molecular weight of 560.74 g/mol. Its IUPAC name is (NE)-N-[(5Z)-5-[(3-heptoxy-4-methoxyphenyl)methylidene]-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | (NE)-N-[(5Z)-5-[(3-heptoxy-4-methoxyphenyl)methylidene]-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 6082988 |
| Molecular Formula | C28H36N2O6S2 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | (NE)-N-[(5Z)-5-[(3-heptoxy-4-methoxyphenyl)methylidene]-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | CCCCCCCOc1cc(/C=C2\S/C(=N/S(=O)(=O)c3ccccc3)N(CCCOC)C2=O)ccc1OC |
| InChI | InChI=1S/C28H36N2O6S2/c1-4-5-6-7-11-19-36-25-20-22(15-16-24(25)35-3)21-26-27(31)30(17-12-18-34-2)28(37-26)29-38(32,33)23-13-9-8-10-14-23/h8-10,13-16,20-21H,4-7,11-12,17-19H2,1-3H3/b26-21-,29-28+ |
| InChIKey | KDCIJNMKLOQLFU-YHBOIVBKSA-N |
| XLogP | 5.74 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|