C27H31FN2O5S2 — CID 4602153
4-fluoro-N-[5-[(3-heptoxy-4-methoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 4602153) has the molecular formula C27H31FN2O5S2 and a molecular weight of 546.69 g/mol. Its IUPAC name is 4-fluoro-N-[5-[(3-heptoxy-4-methoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[5-[(3-heptoxy-4-methoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 4602153 |
| Molecular Formula | C27H31FN2O5S2 |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | 4-fluoro-N-[5-[(3-heptoxy-4-methoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | C=CCN1C(=O)C(=Cc2ccc(OC)c(OCCCCCCC)c2)SC1=NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H31FN2O5S2/c1-4-6-7-8-9-17-35-24-18-20(10-15-23(24)34-3)19-25-26(31)30(16-5-2)27(36-25)29-37(32,33)22-13-11-21(28)12-14-22/h5,10-15,18-19H,2,4,6-9,16-17H2,1,3H3 |
| InChIKey | ZZGZYDQLUIXEED-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|