C25H29ClN2O5S3 — CID 4006881
5-chloro-N-[5-[(3-heptoxy-4-methoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide (PubChem CID 4006881) has the molecular formula C25H29ClN2O5S3 and a molecular weight of 569.17 g/mol. Its IUPAC name is 5-chloro-N-[5-[(3-heptoxy-4-methoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[5-[(3-heptoxy-4-methoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 4006881 |
| Molecular Formula | C25H29ClN2O5S3 |
| Molecular Weight | 569.17 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | 5-chloro-N-[5-[(3-heptoxy-4-methoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
| SMILES | C=CCN1C(=O)C(=Cc2ccc(OC)c(OCCCCCCC)c2)SC1=NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C25H29ClN2O5S3/c1-4-6-7-8-9-15-33-20-16-18(10-11-19(20)32-3)17-21-24(29)28(14-5-2)25(34-21)27-36(30,31)23-13-12-22(26)35-23/h5,10-13,16-17H,2,4,6-9,14-15H2,1,3H3 |
| InChIKey | QEWWPFOLEUTGNW-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.17 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|