C18H15ClN2O4S3 — CID 3527620
5-chloro-N-[5-[(3-methoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide (PubChem CID 3527620) has the molecular formula C18H15ClN2O4S3 and a molecular weight of 454.98 g/mol. Its IUPAC name is 5-chloro-N-[5-[(3-methoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[5-[(3-methoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3527620 |
| Molecular Formula | C18H15ClN2O4S3 |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 453.99 |
| IUPAC Name | 5-chloro-N-[5-[(3-methoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
| SMILES | C=CCN1C(=O)C(=Cc2cccc(OC)c2)SC1=NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H15ClN2O4S3/c1-3-9-21-17(22)14(11-12-5-4-6-13(10-12)25-2)26-18(21)20-28(23,24)16-8-7-15(19)27-16/h3-8,10-11H,1,9H2,2H3 |
| InChIKey | VNSDQYDPQHZMRW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|