C25H20Cl2N2O5S3 — CID 98157193
5-chloro-N-[(5Z)-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide (PubChem CID 98157193) has the molecular formula C25H20Cl2N2O5S3 and a molecular weight of 595.55 g/mol. Its IUPAC name is 5-chloro-N-[(5Z)-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(5Z)-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 98157193 |
| Molecular Formula | C25H20Cl2N2O5S3 |
| Molecular Weight | 595.55 g/mol |
| Exact Mass | 593.99 |
| IUPAC Name | 5-chloro-N-[(5Z)-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
| SMILES | C=CCN1C(=O)/C(=C/c2ccc(OCc3ccccc3Cl)c(OC)c2)SC1=NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C25H20Cl2N2O5S3/c1-3-12-29-24(30)21(35-25(29)28-37(31,32)23-11-10-22(27)36-23)14-16-8-9-19(20(13-16)33-2)34-15-17-6-4-5-7-18(17)26/h3-11,13-14H,1,12,15H2,2H3/b21-14-,28-25? |
| InChIKey | LMKBZVOSUJWVLV-OHMBLGONSA-N |
| XLogP | 6.49 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.55 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|