C29H28N2O5S2 — CID 98157148
4-ethyl-N-[(5Z)-5-[(4-methoxy-3-phenylmethoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 98157148) has the molecular formula C29H28N2O5S2 and a molecular weight of 548.69 g/mol. Its IUPAC name is 4-ethyl-N-[(5Z)-5-[(4-methoxy-3-phenylmethoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | 4-ethyl-N-[(5Z)-5-[(4-methoxy-3-phenylmethoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 98157148 |
| Molecular Formula | C29H28N2O5S2 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 4-ethyl-N-[(5Z)-5-[(4-methoxy-3-phenylmethoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | C=CCN1C(=O)/C(=C/c2ccc(OC)c(OCc3ccccc3)c2)SC1=NS(=O)(=O)c1ccc(CC)cc1 |
| InChI | InChI=1S/C29H28N2O5S2/c1-4-17-31-28(32)27(37-29(31)30-38(33,34)24-14-11-21(5-2)12-15-24)19-23-13-16-25(35-3)26(18-23)36-20-22-9-7-6-8-10-22/h4,6-16,18-19H,1,5,17,20H2,2-3H3/b27-19-,30-29? |
| InChIKey | LALAJDHBQMKOJG-WBLURPLBSA-N |
| XLogP | 5.68 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|