C24H22N2O5S3 — CID 4002973
N-[3-ethyl-5-[(4-methoxy-3-phenylmethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide (PubChem CID 4002973) has the molecular formula C24H22N2O5S3 and a molecular weight of 514.65 g/mol. Its IUPAC name is N-[3-ethyl-5-[(4-methoxy-3-phenylmethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide.
| Compound Name | N-[3-ethyl-5-[(4-methoxy-3-phenylmethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 4002973 |
| Molecular Formula | C24H22N2O5S3 |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | N-[3-ethyl-5-[(4-methoxy-3-phenylmethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
| SMILES | CCN1C(=O)C(=Cc2ccc(OC)c(OCc3ccccc3)c2)SC1=NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C24H22N2O5S3/c1-3-26-23(27)21(33-24(26)25-34(28,29)22-10-7-13-32-22)15-18-11-12-19(30-2)20(14-18)31-16-17-8-5-4-6-9-17/h4-15H,3,16H2,1-2H3 |
| InChIKey | KHAIXCDEDYWRMR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|