C14H12N2O4S3 — CID 7273187
N-[(5Z)-3-ethyl-5-(furan-2-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide (PubChem CID 7273187) has the molecular formula C14H12N2O4S3 and a molecular weight of 368.46 g/mol. Its IUPAC name is N-[(5Z)-3-ethyl-5-(furan-2-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide.
| Compound Name | N-[(5Z)-3-ethyl-5-(furan-2-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 7273187 |
| Molecular Formula | C14H12N2O4S3 |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | N-[(5Z)-3-ethyl-5-(furan-2-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
| SMILES | CCN1C(=O)/C(=C/c2ccco2)SC1=NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H12N2O4S3/c1-2-16-13(17)11(9-10-5-3-7-20-10)22-14(16)15-23(18,19)12-6-4-8-21-12/h3-9H,2H2,1H3/b11-9-,15-14? |
| InChIKey | ZTWVFDVLFZHIJM-HPYCBCPESA-N |
| XLogP | 3.02 |
| TPSA | 79.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|