C16H14N2O5S3 — CID 7273188
N-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide (PubChem CID 7273188) has the molecular formula C16H14N2O5S3 and a molecular weight of 410.50 g/mol. Its IUPAC name is N-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide.
| Compound Name | N-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 7273188 |
| Molecular Formula | C16H14N2O5S3 |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | N-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
| SMILES | CCN1C(=O)/C(=C/c2ccc(O)cc2O)SC1=NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C16H14N2O5S3/c1-2-18-15(21)13(8-10-5-6-11(19)9-12(10)20)25-16(18)17-26(22,23)14-4-3-7-24-14/h3-9,19-20H,2H2,1H3/b13-8-,17-16? |
| InChIKey | AFPACYFOTIZBQJ-KFZSMYBBSA-N |
| XLogP | 2.84 |
| TPSA | 107.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|