C16H12ClFN2O3S3 — CID 3446495
5-chloro-N-[3-ethyl-5-[(2-fluorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide (PubChem CID 3446495) has the molecular formula C16H12ClFN2O3S3 and a molecular weight of 430.94 g/mol. Its IUPAC name is 5-chloro-N-[3-ethyl-5-[(2-fluorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[3-ethyl-5-[(2-fluorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3446495 |
| Molecular Formula | C16H12ClFN2O3S3 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 429.97 |
| IUPAC Name | 5-chloro-N-[3-ethyl-5-[(2-fluorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
| SMILES | CCN1C(=O)C(=Cc2ccccc2F)SC1=NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H12ClFN2O3S3/c1-2-20-15(21)12(9-10-5-3-4-6-11(10)18)24-16(20)19-26(22,23)14-8-7-13(17)25-14/h3-9H,2H2,1H3 |
| InChIKey | KOICAACUIYCERI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|