C20H19FN2O4S2 — CID 4653048
N-[5-[(2-fluorophenyl)methylidene]-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 4653048) has the molecular formula C20H19FN2O4S2 and a molecular weight of 434.51 g/mol. Its IUPAC name is N-[5-[(2-fluorophenyl)methylidene]-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | N-[5-[(2-fluorophenyl)methylidene]-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 4653048 |
| Molecular Formula | C20H19FN2O4S2 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | N-[5-[(2-fluorophenyl)methylidene]-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | COCCCN1C(=O)C(=Cc2ccccc2F)SC1=NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19FN2O4S2/c1-27-13-7-12-23-19(24)18(14-15-8-5-6-11-17(15)21)28-20(23)22-29(25,26)16-9-3-2-4-10-16/h2-6,8-11,14H,7,12-13H2,1H3 |
| InChIKey | VTAOAFNLKHMMSN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|