C15H12N2O3S4 — CID 18398171
(NZ)-N-[(5Z)-4-oxo-3-prop-2-enyl-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide (PubChem CID 18398171) has the molecular formula C15H12N2O3S4 and a molecular weight of 396.54 g/mol. Its IUPAC name is (NZ)-N-[(5Z)-4-oxo-3-prop-2-enyl-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide.
| Compound Name | (NZ)-N-[(5Z)-4-oxo-3-prop-2-enyl-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 18398171 |
| Molecular Formula | C15H12N2O3S4 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 395.97 |
| IUPAC Name | (NZ)-N-[(5Z)-4-oxo-3-prop-2-enyl-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
| SMILES | C=CCN1C(=O)/C(=C/c2cccs2)S/C1=N\S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H12N2O3S4/c1-2-7-17-14(18)12(10-11-5-3-8-21-11)23-15(17)16-24(19,20)13-6-4-9-22-13/h2-6,8-10H,1,7H2/b12-10-,16-15- |
| InChIKey | TYSDPGAXWTYTHD-LYZHNOTLSA-N |
| XLogP | 3.66 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|