C12H14N2O3S3 — CID 4535450
N-(5-ethyl-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene)thiophene-2-sulfonamide (PubChem CID 4535450) has the molecular formula C12H14N2O3S3 and a molecular weight of 330.46 g/mol. Its IUPAC name is N-(5-ethyl-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene)thiophene-2-sulfonamide.
| Compound Name | N-(5-ethyl-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 4535450 |
| Molecular Formula | C12H14N2O3S3 |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | N-(5-ethyl-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene)thiophene-2-sulfonamide |
| SMILES | C=CCN1C(=O)C(CC)SC1=NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C12H14N2O3S3/c1-3-7-14-11(15)9(4-2)19-12(14)13-20(16,17)10-6-5-8-18-10/h3,5-6,8-9H,1,4,7H2,2H3 |
| InChIKey | FVPGUXKGRQWVHQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|