C15H20N2O3S3 — CID 2443118
N-[(5R)-3-cyclohexyl-5-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide (PubChem CID 2443118) has the molecular formula C15H20N2O3S3 and a molecular weight of 372.54 g/mol. Its IUPAC name is N-[(5R)-3-cyclohexyl-5-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide.
| Compound Name | N-[(5R)-3-cyclohexyl-5-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2443118 |
| Molecular Formula | C15H20N2O3S3 |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | N-[(5R)-3-cyclohexyl-5-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
| SMILES | CC[C@H]1SC(=NS(=O)(=O)c2cccs2)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C15H20N2O3S3/c1-2-12-14(18)17(11-7-4-3-5-8-11)15(22-12)16-23(19,20)13-9-6-10-21-13/h6,9-12H,2-5,7-8H2,1H3/t12-/m1/s1 |
| InChIKey | KEOKPNMCWRVXNB-GFCCVEGCSA-N |
| XLogP | 3.48 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|