C11H12N2O3S3 — CID 7273269
N-[(5S)-5-methyl-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide (PubChem CID 7273269) has the molecular formula C11H12N2O3S3 and a molecular weight of 316.43 g/mol. Its IUPAC name is N-[(5S)-5-methyl-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide.
| Compound Name | N-[(5S)-5-methyl-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 7273269 |
| Molecular Formula | C11H12N2O3S3 |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | N-[(5S)-5-methyl-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
| SMILES | C=CCN1C(=O)[C@H](C)SC1=NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C11H12N2O3S3/c1-3-6-13-10(14)8(2)18-11(13)12-19(15,16)9-5-4-7-17-9/h3-5,7-8H,1,6H2,2H3/t8-/m0/s1 |
| InChIKey | LNIWZECCMKMTIM-QMMMGPOBSA-N |
| XLogP | 1.94 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|