C23H23N3O3S3 — CID 3881009
N-[4-oxo-3-prop-2-enyl-5-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide (PubChem CID 3881009) has the molecular formula C23H23N3O3S3 and a molecular weight of 485.66 g/mol. Its IUPAC name is N-[4-oxo-3-prop-2-enyl-5-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide.
| Compound Name | N-[4-oxo-3-prop-2-enyl-5-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3881009 |
| Molecular Formula | C23H23N3O3S3 |
| Molecular Weight | 485.66 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | N-[4-oxo-3-prop-2-enyl-5-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
| SMILES | C=CCN1C(=O)C(=CC=C2N(C)c3ccccc3C2(C)C)SC1=NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C23H23N3O3S3/c1-5-14-26-21(27)18(31-22(26)24-32(28,29)20-11-8-15-30-20)12-13-19-23(2,3)16-9-6-7-10-17(16)25(19)4/h5-13,15H,1,14H2,2-4H3 |
| InChIKey | DOBVSGTUIWFCFD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.66 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|