C28H25N3O2 — CID 58473494
1,2-diphenyl-4-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyrazolidine-3,5-dione (PubChem CID 58473494) has the molecular formula C28H25N3O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 1,2-diphenyl-4-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyrazolidine-3,5-dione.
| Compound Name | 1,2-diphenyl-4-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 58473494 |
| Molecular Formula | C28H25N3O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 1,2-diphenyl-4-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyrazolidine-3,5-dione |
| SMILES | CN1/C(=C/C=C2C(=O)N(c3ccccc3)N(c3ccccc3)C2=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C28H25N3O2/c1-28(2)23-16-10-11-17-24(23)29(3)25(28)19-18-22-26(32)30(20-12-6-4-7-13-20)31(27(22)33)21-14-8-5-9-15-21/h4-19H,1-3H3/b25-19+ |
| InChIKey | BWAUVNWEYRRTFQ-NCELDCMTSA-N |
| XLogP | 5.22 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|