C18H21N3O — CID 54402595
2,5-dimethyl-4-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyrazol-3-one (PubChem CID 54402595) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is 2,5-dimethyl-4-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyrazol-3-one.
| Compound Name | 2,5-dimethyl-4-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyrazol-3-one |
|---|---|
| PubChem CID | 54402595 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 2,5-dimethyl-4-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyrazol-3-one |
| SMILES | CC1=NN(C)C(=O)C1=CC=C1N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C18H21N3O/c1-12-13(17(22)21(5)19-12)10-11-16-18(2,3)14-8-6-7-9-15(14)20(16)4/h6-11H,1-5H3 |
| InChIKey | VOMGMMYGRRNLPV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|