C15H21N2+ — CID 18526952
dimethyl-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]azanium (PubChem CID 18526952) has the molecular formula C15H21N2+ and a molecular weight of 229.35 g/mol. Its IUPAC name is dimethyl-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]azanium.
| Compound Name | dimethyl-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]azanium |
|---|---|
| PubChem CID | 18526952 |
| Molecular Formula | C15H21N2+ |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | dimethyl-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]azanium |
| SMILES | CN1/C(=C/C=[N+](C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C15H21N2/c1-15(2)12-8-6-7-9-13(12)17(5)14(15)10-11-16(3)4/h6-11H,1-5H3/q+1 |
| InChIKey | BGBICWOROGIHNB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|