C21H25N2O+ — CID 72728773
(4-methoxyphenyl)-methyl-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]azanium (PubChem CID 72728773) has the molecular formula C21H25N2O+ and a molecular weight of 321.44 g/mol. Its IUPAC name is (4-methoxyphenyl)-methyl-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]azanium.
| Compound Name | (4-methoxyphenyl)-methyl-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]azanium |
|---|---|
| PubChem CID | 72728773 |
| Molecular Formula | C21H25N2O+ |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | (4-methoxyphenyl)-methyl-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]azanium |
| SMILES | COc1ccc(/[N+](C)=C/C=C2N(C)c3ccccc3C2(C)C)cc1 |
| InChI | InChI=1S/C21H25N2O/c1-21(2)18-8-6-7-9-19(18)23(4)20(21)14-15-22(3)16-10-12-17(24-5)13-11-16/h6-15H,1-5H3/q+1 |
| InChIKey | GFHUQTRZDOPFRW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|