C15H21ClN2O4 — CID 73448945
dimethyl-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]azanium perchlorate (PubChem CID 73448945) has the molecular formula C15H21ClN2O4 and a molecular weight of 328.80 g/mol. Its IUPAC name is dimethyl-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]azanium perchlorate.
| Compound Name | dimethyl-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]azanium perchlorate |
|---|---|
| PubChem CID | 73448945 |
| Molecular Formula | C15H21ClN2O4 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | dimethyl-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]azanium perchlorate |
| SMILES | CN1C(=CC=[N+](C)C)C(C)(C)c2ccccc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C15H21N2.ClHO4/c1-15(2)12-8-6-7-9-13(12)17(5)14(15)10-11-16(3)4;2-1(3,4)5/h6-11H,1-5H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | WUFTZXHXAIPQRY-UHFFFAOYSA-M |
| XLogP | -2.12 |
| TPSA | 98.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|