C28H32N2O2-2 — CID 15508580
2,4-bis[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutane-1,3-diolate (PubChem CID 15508580) has the molecular formula C28H32N2O2-2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 2,4-bis[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutane-1,3-diolate.
| Compound Name | 2,4-bis[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutane-1,3-diolate |
|---|---|
| PubChem CID | 15508580 |
| Molecular Formula | C28H32N2O2-2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 2,4-bis[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutane-1,3-diolate |
| SMILES | CN1/C(=C\C2C([O-])C(/C=C3\N(C)c4ccccc4C3(C)C)C2[O-])C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C28H32N2O2/c1-27(2)19-11-7-9-13-21(19)29(5)23(27)15-17-25(31)18(26(17)32)16-24-28(3,4)20-12-8-10-14-22(20)30(24)6/h7-18,25-26H,1-6H3/q-2/b23-15-,24-16- |
| InChIKey | QXCZYFDQGHYIEU-MPKYGIEOSA-N |
| XLogP | 3.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |