C19H25N2+ — CID 2770749
dimethyl-[6-(1,3,3-trimethylindol-2-ylidene)hexa-2,4-dienylidene]azanium (PubChem CID 2770749) has the molecular formula C19H25N2+ and a molecular weight of 281.42 g/mol. Its IUPAC name is dimethyl-[6-(1,3,3-trimethylindol-2-ylidene)hexa-2,4-dienylidene]azanium.
| Compound Name | dimethyl-[6-(1,3,3-trimethylindol-2-ylidene)hexa-2,4-dienylidene]azanium |
|---|---|
| PubChem CID | 2770749 |
| Molecular Formula | C19H25N2+ |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | dimethyl-[6-(1,3,3-trimethylindol-2-ylidene)hexa-2,4-dienylidene]azanium |
| SMILES | CN1C(=CC=CC=CC=[N+](C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C19H25N2/c1-19(2)16-12-9-10-13-17(16)21(5)18(19)14-8-6-7-11-15-20(3)4/h6-15H,1-5H3/q+1 |
| InChIKey | BKLFNFFYHHGTTQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|