C18H21NO — CID 102091783
(2E,4E,6Z)-2-methyl-6-(1,3,3-trimethylindol-2-ylidene)hexa-2,4-dienal (PubChem CID 102091783) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is (2E,4E,6Z)-2-methyl-6-(1,3,3-trimethylindol-2-ylidene)hexa-2,4-dienal.
| Compound Name | (2E,4E,6Z)-2-methyl-6-(1,3,3-trimethylindol-2-ylidene)hexa-2,4-dienal |
|---|---|
| PubChem CID | 102091783 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | (2E,4E,6Z)-2-methyl-6-(1,3,3-trimethylindol-2-ylidene)hexa-2,4-dienal |
| SMILES | C/C(C=O)=C\C=C\C=C1/N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C18H21NO/c1-14(13-20)9-5-8-12-17-18(2,3)15-10-6-7-11-16(15)19(17)4/h5-13H,1-4H3/b8-5+,14-9+,17-12- |
| InChIKey | VFCSRKRUUJLUHH-VYTZWMDKSA-N |
| XLogP | 4.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|