C30H33N — CID 59902058
1,3,3-trimethyl-2-[7-(1,1,3-trimethylinden-2-yl)hepta-2,4,6-trienylidene]indole (PubChem CID 59902058) has the molecular formula C30H33N and a molecular weight of 407.60 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[7-(1,1,3-trimethylinden-2-yl)hepta-2,4,6-trienylidene]indole.
| Compound Name | 1,3,3-trimethyl-2-[7-(1,1,3-trimethylinden-2-yl)hepta-2,4,6-trienylidene]indole |
|---|---|
| PubChem CID | 59902058 |
| Molecular Formula | C30H33N |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 1,3,3-trimethyl-2-[7-(1,1,3-trimethylinden-2-yl)hepta-2,4,6-trienylidene]indole |
| SMILES | CC1=C(C=CC=CC=CC=C2N(C)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C30H33N/c1-22-23-16-12-13-18-25(23)29(2,3)24(22)17-10-8-7-9-11-21-28-30(4,5)26-19-14-15-20-27(26)31(28)6/h7-21H,1-6H3 |
| InChIKey | WFRSOGSDOGQTJA-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|