C24H25N2S+ — CID 177431281
3-methyl-2-[(1E,3E,5E)-5-(1,3,3-trimethylindol-2-ylidene)penta-1,3-dienyl]-1,3-benzothiazol-3-ium (PubChem CID 177431281) has the molecular formula C24H25N2S+ and a molecular weight of 373.55 g/mol. Its IUPAC name is 3-methyl-2-[(1E,3E,5E)-5-(1,3,3-trimethylindol-2-ylidene)penta-1,3-dienyl]-1,3-benzothiazol-3-ium.
| Compound Name | 3-methyl-2-[(1E,3E,5E)-5-(1,3,3-trimethylindol-2-ylidene)penta-1,3-dienyl]-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 177431281 |
| Molecular Formula | C24H25N2S+ |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 3-methyl-2-[(1E,3E,5E)-5-(1,3,3-trimethylindol-2-ylidene)penta-1,3-dienyl]-1,3-benzothiazol-3-ium |
| SMILES | CN1/C(=C/C=C/C=C/c2sc3ccccc3[n+]2C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C24H25N2S/c1-24(2)18-12-8-9-13-19(18)25(3)22(24)16-6-5-7-17-23-26(4)20-14-10-11-15-21(20)27-23/h5-17H,1-4H3/q+1 |
| InChIKey | KONNBPWLPMGGSE-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|