C21H23N2S+ — CID 118242626
3-ethyl-2-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]-1,3-benzothiazol-3-ium (PubChem CID 118242626) has the molecular formula C21H23N2S+ and a molecular weight of 335.50 g/mol. Its IUPAC name is 3-ethyl-2-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]-1,3-benzothiazol-3-ium.
| Compound Name | 3-ethyl-2-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 118242626 |
| Molecular Formula | C21H23N2S+ |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 3-ethyl-2-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]-1,3-benzothiazol-3-ium |
| SMILES | CC[n+]1c(/C=C2/N(C)c3ccccc3C2(C)C)sc2ccccc21 |
| InChI | InChI=1S/C21H23N2S/c1-5-23-17-12-8-9-13-18(17)24-20(23)14-19-21(2,3)15-10-6-7-11-16(15)22(19)4/h6-14H,5H2,1-4H3/q+1 |
| InChIKey | PGDQCALUOGNFOM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|