C32H29N2O2S2+ — CID 157057104
2-[(1-benzyl-3,3-dimethylindol-2-ylidene)methyl]-4-[[3-(2-hydroxyethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-3-sulfanylcyclobut-2-en-1-one (PubChem CID 157057104) has the molecular formula C32H29N2O2S2+ and a molecular weight of 537.73 g/mol. Its IUPAC name is 2-[(1-benzyl-3,3-dimethylindol-2-ylidene)methyl]-4-[[3-(2-hydroxyethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-3-sulfanylcyclobut-2-en-1-one.
| Compound Name | 2-[(1-benzyl-3,3-dimethylindol-2-ylidene)methyl]-4-[[3-(2-hydroxyethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-3-sulfanylcyclobut-2-en-1-one |
|---|---|
| PubChem CID | 157057104 |
| Molecular Formula | C32H29N2O2S2+ |
| Molecular Weight | 537.73 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 2-[(1-benzyl-3,3-dimethylindol-2-ylidene)methyl]-4-[[3-(2-hydroxyethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-3-sulfanylcyclobut-2-en-1-one |
| SMILES | CC1(C)C(=CC2=C(S)C(=Cc3sc4ccccc4[n+]3CCO)C2=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C32H28N2O2S2/c1-32(2)24-12-6-7-13-25(24)34(20-21-10-4-3-5-11-21)28(32)18-22-30(36)23(31(22)37)19-29-33(16-17-35)26-14-8-9-15-27(26)38-29/h3-15,18-19,35H,16-17,20H2,1-2H3/p+1 |
| InChIKey | QFLXHDKIEXPESJ-UHFFFAOYSA-O |
| XLogP | 6.21 |
| TPSA | 44.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.73 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|