C20H21IN2OS2 — CID 146051099
2-[2-[(Z)-(3-ethyl-5-methyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]ethanol iodide (PubChem CID 146051099) has the molecular formula C20H21IN2OS2 and a molecular weight of 496.44 g/mol. Its IUPAC name is 2-[2-[(Z)-(3-ethyl-5-methyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]ethanol iodide.
| Compound Name | 2-[2-[(Z)-(3-ethyl-5-methyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]ethanol iodide |
|---|---|
| PubChem CID | 146051099 |
| Molecular Formula | C20H21IN2OS2 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | 2-[2-[(Z)-(3-ethyl-5-methyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]ethanol iodide |
| SMILES | CCN1/C(=C/c2sc3ccccc3[n+]2CCO)Sc2ccc(C)cc21.[I-] |
| InChI | InChI=1S/C20H21N2OS2.HI/c1-3-21-16-12-14(2)8-9-18(16)25-19(21)13-20-22(10-11-23)15-6-4-5-7-17(15)24-20;/h4-9,12-13,23H,3,10-11H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | QITLUALMFQAWOX-UHFFFAOYSA-M |
| XLogP | 1.42 |
| TPSA | 27.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|