C21H19Cl2N2O2S2+ — CID 59043333
4-[5-chloro-2-[(Z)-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]butanoic acid (PubChem CID 59043333) has the molecular formula C21H19Cl2N2O2S2+ and a molecular weight of 466.44 g/mol. Its IUPAC name is 4-[5-chloro-2-[(Z)-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]butanoic acid.
| Compound Name | 4-[5-chloro-2-[(Z)-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]butanoic acid |
|---|---|
| PubChem CID | 59043333 |
| Molecular Formula | C21H19Cl2N2O2S2+ |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | 4-[5-chloro-2-[(Z)-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]butanoic acid |
| SMILES | CCN1/C(=C/c2sc3ccc(Cl)cc3[n+]2CCCC(=O)O)Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H18Cl2N2O2S2/c1-2-24-15-10-13(22)5-7-17(15)28-19(24)12-20-25(9-3-4-21(26)27)16-11-14(23)6-8-18(16)29-20/h5-8,10-12H,2-4,9H2,1H3/p+1 |
| InChIKey | PRFJNMYOSBEHAY-UHFFFAOYSA-O |
| XLogP | 6.29 |
| TPSA | 44.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|