C23H25Cl2N2O5S4+ — CID 123829417
3-[5-chloro-2-[[5-chloro-3-(3-ethylsulfonylpropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid (PubChem CID 123829417) has the molecular formula C23H25Cl2N2O5S4+ and a molecular weight of 608.64 g/mol. Its IUPAC name is 3-[5-chloro-2-[[5-chloro-3-(3-ethylsulfonylpropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[5-chloro-2-[[5-chloro-3-(3-ethylsulfonylpropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 123829417 |
| Molecular Formula | C23H25Cl2N2O5S4+ |
| Molecular Weight | 608.64 g/mol |
| Exact Mass | 607.00 |
| IUPAC Name | 3-[5-chloro-2-[[5-chloro-3-(3-ethylsulfonylpropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
| SMILES | CCS(=O)(=O)CCC[n+]1c(C=C2Sc3ccc(Cl)cc3N2CCCS(=O)(=O)O)sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C23H24Cl2N2O5S4/c1-2-35(28,29)11-3-9-26-18-13-16(24)5-7-20(18)33-22(26)15-23-27(10-4-12-36(30,31)32)19-14-17(25)6-8-21(19)34-23/h5-8,13-15H,2-4,9-12H2,1H3/p+1 |
| InChIKey | YENITIQLTRFGIC-UHFFFAOYSA-O |
| XLogP | 5.51 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|