C25H24ClN2O6S5+ — CID 54416116
3-[5-chloro-2-[[3-(3-sulfopropyl)-5-thiophen-2-yl-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid (PubChem CID 54416116) has the molecular formula C25H24ClN2O6S5+ and a molecular weight of 644.26 g/mol. Its IUPAC name is 3-[5-chloro-2-[[3-(3-sulfopropyl)-5-thiophen-2-yl-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[5-chloro-2-[[3-(3-sulfopropyl)-5-thiophen-2-yl-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 54416116 |
| Molecular Formula | C25H24ClN2O6S5+ |
| Molecular Weight | 644.26 g/mol |
| Exact Mass | 642.99 |
| IUPAC Name | 3-[5-chloro-2-[[3-(3-sulfopropyl)-5-thiophen-2-yl-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCN1C(=Cc2sc3ccc(-c4cccs4)cc3[n+]2CCCS(=O)(=O)O)Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H23ClN2O6S5/c26-18-6-8-23-20(15-18)28(10-3-13-39(32,33)34)25(37-23)16-24-27(9-2-12-38(29,30)31)19-14-17(5-7-22(19)36-24)21-4-1-11-35-21/h1,4-8,11,14-16H,2-3,9-10,12-13H2,(H-,29,30,31,32,33,34)/p+1 |
| InChIKey | VXNGJFRPAYZAMV-UHFFFAOYSA-O |
| XLogP | 6.04 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.26 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|